Borate
This page lists Borate compounds supplied by ChemToDo: 10,048 products in total, each identified by its CAS Registry Number. Examples include Glycyl diphenylborinate, 95% (CAS 14335-29-6), N-Propionyl-(2S)-bornane-10,2-sultaM (CAS 195877-80-6), (2S)-(-)-3-exo-(DiMethylaMino)isonorborneol (CAS 103729-96-0), 2,4-BIS-(BENZYLOXY)-5-(5,5-DIMETHYL-[1,3,2]-DIOXABORINAN-2-YL)PYRIMIDINE (CAS 1072944-91-2), 6-Methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1152427-91-2). Open a product page for its molecular formula, identifiers and synonyms, or send an inquiry for purity, packaging, price and lead time.
| CAS Number | Chemical Name | Catalog No. |
|---|---|---|
| 14335-29-6 | Glycyl diphenylborinate, 95% | 104899 |
| 195877-80-6 | N-Propionyl-(2S)-bornane-10,2-sultaM | 105475 |
| 103729-96-0 | (2S)-(-)-3-exo-(DiMethylaMino)isonorborneol | 106865 |
| 1072944-91-2 | 2,4-BIS-(BENZYLOXY)-5-(5,5-DIMETHYL-[1,3,2]-DIOXABORINAN-2-YL)PYRIMIDINE | 107015 |
| 1152427-91-2 | 6-Methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione | 107184 |
| 117098-94-9 | 6-aMinobenzo[c][1,2]oxaborol-1(3H)-ol | 107265 |
| 1192483-03-6 | {[(1R,2R)-2-amino-1,2-diphenylethyl](4-toluenesulfonyl)amido}(p-cymene)ruthenium(II) tetrafluoroborate, min. 97% | 107406 |
| 1233131-18-4 | 4-(quinoliN-8-yl)phenylbornic acid,pinacol ester | 107590 |
| 1255640-57-3 | Tri-o-tolylphosphine tetrafluoroborate | 107658 |
| 1257649-56-1 | 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione | 107686 |
| 446065-12-9 | N-Pentyltrifluoroboratepotassium salt | 107873 |
| 403655-97-0 | (S)-3-AMINO-2-OXETANONE TETRAFLUOROBORATE | 107971 |